Others
Featured Products
2,2-diphenyltetrahydrofuran
- Chemical Name: 2,2-diphenyltetrahydrofuran
- CAS: 887-15-0
- Purity: 99%
Top Quality Chinese Factory supply 887-15-0 2,2-diphenyltetrahydrofuran We supply high quality 2,2-diphenyltetrahydrofuran (CAS 887-15-0), in stock, factory directly supply to clients, lower prices, more competitiveness.
What is the 2,2-diphenyltetrahydrofuran ?
2,2-diphenyltetrahydrofuran is , while it's Molecular Formula is C16H16 O. Used in Organic Synthesis:
2,2-diphenyltetrahydrofuran is used as a reagent in organic synthesis for the preparation of various types of compounds such as pharmaceuticals, agrochemicals, and flavors. Its unique structure and reactivity contribute to the synthesis of a wide range of chemical compounds.
Used in Pharmaceutical Industry:
In the pharmaceutical industry, 2,2-diphenyltetrahydrofuran is used as a key intermediate in the synthesis of various drug molecules. Its versatility allows for the development of new pharmaceutical compounds with potential therapeutic applications.
Used in Agrochemical Industry:
2,2-diphenyltetrahydrofuran is utilized as a building block in the synthesis of agrochemicals, such as pesticides and herbicides. Its reactivity and stability make it suitable for the development of effective and environmentally friendly agrochemical products.
Used in Flavor Industry:
In the flavor industry, 2,2-diphenyltetrahydrofuran is used as a precursor for the synthesis of various flavor compounds. Its unique structure allows for the creation of novel and complex flavor profiles for use in food and beverage products.
What is the CAS number for 2,2-diphenyltetrahydrofuran ?
The CAS number of 2,2-diphenyltetrahydrofuran is 887-15-0.
More information of 2,2-diphenyltetrahydrofuran 887-15-0 are:
|
Synonyms |
2,2-Diphenyltetrahydrofuran;NSC 89761; Tetrahydro-2,2-diphenylfuran |
|
CAS?Number |
887-15-0 |
|
Molecular Formula |
C16H16 O |
|
Molecular Weight |
224.302 |
|
Density |
1.085g/cm3 |
|
Boiling Point |
339.4°C at 760 mmHg |
|
Flash Point |
153.6°C |
|
HS CODE |
2932190090 |
|
PSA |
9.23000 |
|
LogP |
3.74060 |
What is 2,2-diphenyltetrahydrofuran (887-15-0) used for?
2,2-diphenyltetrahydrofuran is a cyclic ether compound with the molecular formula C16H18O. It is a tetrahydrofuran derivative characterized by its two phenyl groups attached to the tetrahydrofuran ring. This chemical is known for its stability and reactivity, making it a versatile compound in the field of organic chemistry. Its unique structure and properties make it a valuable tool in the development of new chemical compounds and materials.
InChI:InChI=1/C16H16O/c1-3-8-14(9-4-1)16(12-7-13-17-16)15-10-5-2-6-11-15/h1-6,8-11H,7,12-13H2
Articles related to 2,2-diphenyltetrahydrofuran:
|
Article |
Source |
|
Heterocyclization involving benzylic C(sp3)-H functionalization enabled by visible light photoredox catalysis |
Pandey, Ganesh,Laha, Ramkrishna,Mondal, Pradip Kumar , p. 9689 - 9692 (2019/08/15) |
|
Concise, stereodivergent and highly stereoselective synthesis of cis-and trans-2-substituted 3-hydroxypiperidines-development of a phosphite-driven cyclodehydration |
Huy, Peter H.,Westphal, Julia C.,Koskinen, Ari M.P. supporting information, p. 369 - 383 (2014/03/21) |
How to get the best price on 2,2-diphenyltetrahydrofuran?
Shenzhen Simeiquan Biotechnology Co.,Ltd is a quality supplier and manufacturer of 2,2-diphenyltetrahydrofuran . You can buy high quality, low price 2,2-diphenyltetrahydrofuran 887-15-0 here. Contact us.